C29H43F3O4Sn — CID 11204420
ethyl 4-[(2Z)-1,1,1-trifluoro-5-methoxycarbonyl-2-tributylstannylhexa-2,5-dien-3-yl]benzoate (PubChem CID 11204420) has the molecular formula C29H43F3O4Sn and a molecular weight of 631.36 g/mol. Its IUPAC name is ethyl 4-[(2Z)-1,1,1-trifluoro-5-methoxycarbonyl-2-tributylstannylhexa-2,5-dien-3-yl]benzoate.
| Compound Name | ethyl 4-[(2Z)-1,1,1-trifluoro-5-methoxycarbonyl-2-tributylstannylhexa-2,5-dien-3-yl]benzoate |
|---|---|
| PubChem CID | 11204420 |
| Molecular Formula | C29H43F3O4Sn |
| Molecular Weight | 631.36 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | ethyl 4-[(2Z)-1,1,1-trifluoro-5-methoxycarbonyl-2-tributylstannylhexa-2,5-dien-3-yl]benzoate |
| SMILES | C=C(C/C(=C(\C(F)(F)F)[Sn](CCCC)(CCCC)CCCC)c1ccc(C(=O)OCC)cc1)C(=O)OC |
| InChI | InChI=1S/C17H16F3O4.3C4H9.Sn/c1-4-24-16(22)13-7-5-12(6-8-13)14(10-17(18,19)20)9-11(2)15(21)23-3;3*1-3-4-2;/h5-8H,2,4,9H2,1,3H3;3*1,3-4H2,2H3; |
| InChIKey | AEZZMJBCEIDUEZ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.36 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|