About 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide
3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide (PubChem CID 1120450) has the molecular formula C22H23N5O6
and a molecular weight of 453.46 g/mol. Its IUPAC name is 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide |
| PubChem CID | 1120450 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1nn(C)c(C(=O)Nc2cc(C)ccc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23N5O6/c1-12-6-8-16(32-4)14(10-12)23-21(28)18-19(27(30)31)20(26(3)25-18)22(29)24-15-11-13(2)7-9-17(15)33-5/h6-11H,1-5H3,(H,23,28)(H,24,29) |
| InChIKey | DOEWZMPMHPJMAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide?
The IUPAC name of 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide (CID 1120450) is 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide.
What is the SMILES notation for 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide?
The canonical SMILES for 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide is COc1ccc(C)cc1NC(=O)c1nn(C)c(C(=O)Nc2cc(C)ccc2OC)c1[N+](=O)[O-].
What is the InChIKey of 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide?
The InChIKey is DOEWZMPMHPJMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O6/c1-12-6-8-16(32-4)14(10-12)23-21(28)18-19(27(30)31)20(26(3)25-18)22(29)24-15-11-13(2)7-9-17(15)33-5/h6-11H,1-5H3,(H,23,28)(H,24,29).
What are the key properties of 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide?
3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide has a molecular weight of 453.46 g/mol, XLogP of 3.47, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,5-N-bis(2-methoxy-5-methylphenyl)-1-methyl-4-nitropyrazole-3,5-dicarboxamide is sourced from PubChem (CID 1120450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).