C39H52O6Si — CID 11204500
(1R,2E,5Z)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhepta-2,5-dien-1-ol (PubChem CID 11204500) has the molecular formula C39H52O6Si and a molecular weight of 644.93 g/mol. Its IUPAC name is (1R,2E,5Z)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhepta-2,5-dien-1-ol.
| Compound Name | (1R,2E,5Z)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhepta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 11204500 |
| Molecular Formula | C39H52O6Si |
| Molecular Weight | 644.93 g/mol |
| Exact Mass | 644.35 |
| IUPAC Name | (1R,2E,5Z)-7-[tert-butyl(diphenyl)silyl]oxy-1-[(4S,5S)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhepta-2,5-dien-1-ol |
| SMILES | COc1ccc(COCC[C@@H]2OC(C)(C)O[C@H]2[C@H](O)/C=C/C/C(C)=C\CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C39H52O6Si/c1-30(25-28-43-46(38(2,3)4,33-16-10-8-11-17-33)34-18-12-9-13-19-34)15-14-20-35(40)37-36(44-39(5,6)45-37)26-27-42-29-31-21-23-32(41-7)24-22-31/h8-14,16-25,35-37,40H,15,26-29H2,1-7H3/b20-14+,30-25-/t35-,36+,37+/m1/s1 |
| InChIKey | ICIYTHZZKDVRPG-BFZKHTHGSA-N |
| XLogP | 6.95 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.93 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|