C35H53N6O10P — CID 11204954
N-[1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-octoxypropan-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide (PubChem CID 11204954) has the molecular formula C35H53N6O10P and a molecular weight of 748.82 g/mol. Its IUPAC name is N-[1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-octoxypropan-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide.
| Compound Name | N-[1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-octoxypropan-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
|---|---|
| PubChem CID | 11204954 |
| Molecular Formula | C35H53N6O10P |
| Molecular Weight | 748.82 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | N-[1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-octoxypropan-2-yl]-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanamide |
| SMILES | CCCCCCCCOCC(COP(=O)(CCCCCC)Oc1ccc([N+](=O)[O-])cc1)NC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C35H53N6O10P/c1-3-5-7-9-10-14-24-48-26-28(27-49-52(47,25-15-8-6-4-2)50-30-19-17-29(18-20-30)40(43)44)37-33(42)16-12-11-13-23-36-31-21-22-32(41(45)46)35-34(31)38-51-39-35/h17-22,28,36H,3-16,23-27H2,1-2H3,(H,37,42) |
| InChIKey | UYUHGPQQJYPIGC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 211.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.82 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|