C47H65NO6S — CID 11205013
diethyl 7-isocyano-2,12-dimethyl-7-(4-methylphenyl)sulfonyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecanedioate (PubChem CID 11205013) has the molecular formula C47H65NO6S and a molecular weight of 772.10 g/mol. Its IUPAC name is diethyl 7-isocyano-2,12-dimethyl-7-(4-methylphenyl)sulfonyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecanedioate.
| Compound Name | diethyl 7-isocyano-2,12-dimethyl-7-(4-methylphenyl)sulfonyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecanedioate |
|---|---|
| PubChem CID | 11205013 |
| Molecular Formula | C47H65NO6S |
| Molecular Weight | 772.10 g/mol |
| Exact Mass | 771.45 |
| IUPAC Name | diethyl 7-isocyano-2,12-dimethyl-7-(4-methylphenyl)sulfonyl-2,12-bis[4-(2-methylpropyl)phenyl]tridecanedioate |
| SMILES | [C-]#[N+]C(CCCCC(C)(C(=O)OCC)c1ccc(CC(C)C)cc1)(CCCCC(C)(C(=O)OCC)c1ccc(CC(C)C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C47H65NO6S/c1-11-53-43(49)45(8,40-23-19-38(20-24-40)33-35(3)4)29-13-15-31-47(48-10,55(51,52)42-27-17-37(7)18-28-42)32-16-14-30-46(9,44(50)54-12-2)41-25-21-39(22-26-41)34-36(5)6/h17-28,35-36H,11-16,29-34H2,1-9H3 |
| InChIKey | ISWYPJUVJIWHEP-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.10 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|