C45H28CrF3N4O3S — CID 11205117
chromium(3+);5,10,15,20-tetraphenylporphyrin-22,24-diide;trifluoromethanesulfonate (PubChem CID 11205117) has the molecular formula C45H28CrF3N4O3S and a molecular weight of 813.80 g/mol. Its IUPAC name is chromium(3+);5,10,15,20-tetraphenylporphyrin-22,24-diide;trifluoromethanesulfonate.
| Compound Name | chromium(3+);5,10,15,20-tetraphenylporphyrin-22,24-diide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11205117 |
| Molecular Formula | C45H28CrF3N4O3S |
| Molecular Weight | 813.80 g/mol |
| Exact Mass | 813.12 |
| IUPAC Name | chromium(3+);5,10,15,20-tetraphenylporphyrin-22,24-diide;trifluoromethanesulfonate |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.O=S(=O)([O-])C(F)(F)F.[Cr+3] |
| InChI | InChI=1S/C44H28N4.CHF3O3S.Cr/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;2-1(3,4)8(5,6)7;/h1-28H;(H,5,6,7);/q-2;;+3/p-1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;; |
| InChIKey | ZYKSNUYXSMBIQZ-YKKPBKTHSA-M |
| XLogP | 10.63 |
| TPSA | 111.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.80 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|