C37H40Cl2N6O5 — CID 11205157
(2S,5S,8R,12R)-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-12-morpholin-4-yl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 11205157) has the molecular formula C37H40Cl2N6O5 and a molecular weight of 719.67 g/mol. Its IUPAC name is (2S,5S,8R,12R)-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-12-morpholin-4-yl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | (2S,5S,8R,12R)-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-12-morpholin-4-yl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 11205157 |
| Molecular Formula | C37H40Cl2N6O5 |
| Molecular Weight | 719.67 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | (2S,5S,8R,12R)-5-benzyl-8-[(3,4-dichlorophenyl)methyl]-2-(1H-indol-3-ylmethyl)-12-morpholin-4-yl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | O=C1C[C@@H](N2CCOCC2)C(=O)NC[C@@H](Cc2ccc(Cl)c(Cl)c2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C37H40Cl2N6O5/c38-28-11-10-24(17-29(28)39)16-26-22-41-37(49)33(45-12-14-50-15-13-45)20-34(46)43-32(19-25-21-40-30-9-5-4-8-27(25)30)36(48)44-31(35(47)42-26)18-23-6-2-1-3-7-23/h1-11,17,21,26,31-33,40H,12-16,18-20,22H2,(H,41,49)(H,42,47)(H,43,46)(H,44,48)/t26-,31+,32+,33-/m1/s1 |
| InChIKey | OZOXDTUEGQWADF-RVLOQZQWSA-N |
| XLogP | 3.18 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |