About 1-nitrocyclohexa-1,3-diene
1-nitrocyclohexa-1,3-diene (PubChem CID 11205752) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-nitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-nitrocyclohexa-1,3-diene |
| PubChem CID | 11205752 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 1-nitrocyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC=CCC1 |
| InChI | InChI=1S/C6H7NO2/c8-7(9)6-4-2-1-3-5-6/h1-2,4H,3,5H2 |
| InChIKey | CFDZFXWXQVKFCI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrocyclohexa-1,3-diene?
The IUPAC name of 1-nitrocyclohexa-1,3-diene (CID 11205752) is 1-nitrocyclohexa-1,3-diene.
What is the SMILES notation for 1-nitrocyclohexa-1,3-diene?
The canonical SMILES for 1-nitrocyclohexa-1,3-diene is O=[N+]([O-])C1=CC=CCC1.
What is the InChIKey of 1-nitrocyclohexa-1,3-diene?
The InChIKey is CFDZFXWXQVKFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c8-7(9)6-4-2-1-3-5-6/h1-2,4H,3,5H2.
What are the key properties of 1-nitrocyclohexa-1,3-diene?
1-nitrocyclohexa-1,3-diene has a molecular weight of 125.13 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrocyclohexa-1,3-diene is sourced from PubChem (CID 11205752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).