About (2S)-3,3-dimethyl-1-nitrobutan-2-ol
(2S)-3,3-dimethyl-1-nitrobutan-2-ol (PubChem CID 11205842) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-1-nitrobutan-2-ol.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-1-nitrobutan-2-ol |
| PubChem CID | 11205842 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (2S)-3,3-dimethyl-1-nitrobutan-2-ol |
| SMILES | CC(C)(C)[C@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C6H13NO3/c1-6(2,3)5(8)4-7(9)10/h5,8H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | POPUCNRCMDNMTD-RXMQYKEDSA-N |
| XLogP | 0.67 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3-dimethyl-1-nitrobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-1-nitrobutan-2-ol?
The IUPAC name of (2S)-3,3-dimethyl-1-nitrobutan-2-ol (CID 11205842) is (2S)-3,3-dimethyl-1-nitrobutan-2-ol.
What is the SMILES notation for (2S)-3,3-dimethyl-1-nitrobutan-2-ol?
The canonical SMILES for (2S)-3,3-dimethyl-1-nitrobutan-2-ol is CC(C)(C)[C@H](O)C[N+](=O)[O-].
What is the InChIKey of (2S)-3,3-dimethyl-1-nitrobutan-2-ol?
The InChIKey is POPUCNRCMDNMTD-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H13NO3/c1-6(2,3)5(8)4-7(9)10/h5,8H,4H2,1-3H3/t5-/m1/s1.
What are the key properties of (2S)-3,3-dimethyl-1-nitrobutan-2-ol?
(2S)-3,3-dimethyl-1-nitrobutan-2-ol has a molecular weight of 147.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-1-nitrobutan-2-ol is sourced from PubChem (CID 11205842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).