C11H20O2 — CID 11206203
(E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enal (PubChem CID 11206203) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enal.
| Compound Name | (E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enal |
|---|---|
| PubChem CID | 11206203 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enal |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)C(C)C=O |
| InChI | InChI=1S/C11H20O2/c1-5-6-7-9(2)11(13-4)10(3)8-12/h5-6,8-11H,7H2,1-4H3/b6-5+/t9-,10?,11+/m0/s1 |
| InChIKey | VEXGMZWYNCVISK-VEAXHWHMSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|