C12H16O2 — CID 11206314
(1R,3S,7S,8S)-3-hydroxy-8-methyltricyclo[5.3.1.03,8]undec-5-en-2-one (PubChem CID 11206314) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,3S,7S,8S)-3-hydroxy-8-methyltricyclo[5.3.1.03,8]undec-5-en-2-one.
| Compound Name | (1R,3S,7S,8S)-3-hydroxy-8-methyltricyclo[5.3.1.03,8]undec-5-en-2-one |
|---|---|
| PubChem CID | 11206314 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R,3S,7S,8S)-3-hydroxy-8-methyltricyclo[5.3.1.03,8]undec-5-en-2-one |
| SMILES | C[C@]12CC[C@@H]3C[C@H]1C=CC[C@@]2(O)C3=O |
| InChI | InChI=1S/C12H16O2/c1-11-6-4-8-7-9(11)3-2-5-12(11,14)10(8)13/h2-3,8-9,14H,4-7H2,1H3/t8-,9-,11+,12-/m1/s1 |
| InChIKey | WOKNQTJTGCQLKN-PKZYVASSSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|