C12H16O2 — CID 11206323
(3aR,7S,8aS)-6-ethenyl-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one (PubChem CID 11206323) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (3aR,7S,8aS)-6-ethenyl-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one.
| Compound Name | (3aR,7S,8aS)-6-ethenyl-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 11206323 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (3aR,7S,8aS)-6-ethenyl-7-methyl-3,3a,4,7,8,8a-hexahydrocyclohepta[b]furan-2-one |
| SMILES | C=CC1=CC[C@@H]2CC(=O)O[C@H]2C[C@@H]1C |
| InChI | InChI=1S/C12H16O2/c1-3-9-4-5-10-7-12(13)14-11(10)6-8(9)2/h3-4,8,10-11H,1,5-7H2,2H3/t8-,10+,11-/m0/s1 |
| InChIKey | ILWIEGLOFNUUQA-GDPRMGEGSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |