methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate

C10H10O4 — CID 11206347

IUPACmethyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCOC(=O)C1Cc2cc(O)ccc2O1
InChIInChI=1S/C10H10O4/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-4,9,11H,5H2,1H3
InChIKeyWQQGWHUQZPKEDL-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.87
Rot. Bonds1

About methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate

methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 11206347) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate
PubChem CID11206347
Molecular FormulaC10H10O4
Molecular Weight194.19 g/mol
Exact Mass194.06
IUPAC Namemethyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate
SMILESCOC(=O)C1Cc2cc(O)ccc2O1
InChIInChI=1S/C10H10O4/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-4,9,11H,5H2,1H3
InChIKeyWQQGWHUQZPKEDL-UHFFFAOYSA-N
XLogP0.87
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate (CID 11206347) is methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate is COC(=O)C1Cc2cc(O)ccc2O1.
What is the InChIKey of methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is WQQGWHUQZPKEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-4,9,11H,5H2,1H3.
What are the key properties of methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate?
methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 194.19 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 11206347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).