About (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate
(5-oxo-1,3-oxathiolan-2-yl)methyl butanoate (PubChem CID 11206498) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate.
Molecular Properties
| Compound Name | (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate |
| PubChem CID | 11206498 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate |
| SMILES | CCCC(=O)OCC1OC(=O)CS1 |
| InChI | InChI=1S/C8H12O4S/c1-2-3-6(9)11-4-8-12-7(10)5-13-8/h8H,2-5H2,1H3 |
| InChIKey | UHTGOHGMLQZWAT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate?
The IUPAC name of (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate (CID 11206498) is (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate.
What is the SMILES notation for (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate?
The canonical SMILES for (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate is CCCC(=O)OCC1OC(=O)CS1.
What is the InChIKey of (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate?
The InChIKey is UHTGOHGMLQZWAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c1-2-3-6(9)11-4-8-12-7(10)5-13-8/h8H,2-5H2,1H3.
What are the key properties of (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate?
(5-oxo-1,3-oxathiolan-2-yl)methyl butanoate has a molecular weight of 204.25 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-1,3-oxathiolan-2-yl)methyl butanoate is sourced from PubChem (CID 11206498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).