About tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate
tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 11206706) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate |
| PubChem CID | 11206706 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-10(2,3)8(7-12)13-9(14)15-11(4,5)6/h8H,7,12H2,1-6H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | PZCDWEOQKBSMMC-MRVPVSSYSA-N |
| XLogP | 1.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate (CID 11206706) is tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate is CC(C)(C)OC(=O)N[C@H](CN)C(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate?
The InChIKey is PZCDWEOQKBSMMC-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-10(2,3)8(7-12)13-9(14)15-11(4,5)6/h8H,7,12H2,1-6H3,(H,13,14)/t8-/m1/s1.
What are the key properties of tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate?
tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate has a molecular weight of 216.32 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-1-amino-3,3-dimethylbutan-2-yl]carbamate is sourced from PubChem (CID 11206706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).