About trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane
trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane (PubChem CID 11206794) has the molecular formula C14H24Si
and a molecular weight of 220.43 g/mol. Its IUPAC name is trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane |
| PubChem CID | 11206794 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane |
| SMILES | CCCC/C=C\C=C/CC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h8-11H,5-7,12H2,1-4H3/b9-8-,11-10- |
| InChIKey | AQPXSAVIIQZVBK-XESWYYRISA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane?
The IUPAC name of trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane (CID 11206794) is trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane.
What is the SMILES notation for trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane?
The canonical SMILES for trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane is CCCC/C=C\C=C/CC#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane?
The InChIKey is AQPXSAVIIQZVBK-XESWYYRISA-N. The full InChI is InChI=1S/C14H24Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h8-11H,5-7,12H2,1-4H3/b9-8-,11-10-.
What are the key properties of trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane?
trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane has a molecular weight of 220.43 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(4Z,6Z)-undeca-4,6-dien-1-ynyl]silane is sourced from PubChem (CID 11206794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).