C12H16O4 — CID 11206860
[(E,3R)-4-formyl-3-(3-oxoprop-1-en-2-yl)hex-4-enyl] acetate (PubChem CID 11206860) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is [(E,3R)-4-formyl-3-(3-oxoprop-1-en-2-yl)hex-4-enyl] acetate.
| Compound Name | [(E,3R)-4-formyl-3-(3-oxoprop-1-en-2-yl)hex-4-enyl] acetate |
|---|---|
| PubChem CID | 11206860 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [(E,3R)-4-formyl-3-(3-oxoprop-1-en-2-yl)hex-4-enyl] acetate |
| SMILES | C=C(C=O)[C@@H](CCOC(C)=O)/C(C=O)=C\C |
| InChI | InChI=1S/C12H16O4/c1-4-11(8-14)12(9(2)7-13)5-6-16-10(3)15/h4,7-8,12H,2,5-6H2,1,3H3/b11-4-/t12-/m1/s1 |
| InChIKey | LZLXLOXEZLDAJS-CSXHZRMWSA-N |
| XLogP | 1.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|