C14H23NO2 — CID 11207129
(1R,2S,3R,6S)-2-butylspiro[7-oxabicyclo[4.1.0]heptane-3,6'-piperidine]-2'-one (PubChem CID 11207129) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (1R,2S,3R,6S)-2-butylspiro[7-oxabicyclo[4.1.0]heptane-3,6'-piperidine]-2'-one.
| Compound Name | (1R,2S,3R,6S)-2-butylspiro[7-oxabicyclo[4.1.0]heptane-3,6'-piperidine]-2'-one |
|---|---|
| PubChem CID | 11207129 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (1R,2S,3R,6S)-2-butylspiro[7-oxabicyclo[4.1.0]heptane-3,6'-piperidine]-2'-one |
| SMILES | CCCC[C@@H]1[C@H]2O[C@H]2CC[C@]12CCCC(=O)N2 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-5-10-13-11(17-13)7-9-14(10)8-4-6-12(16)15-14/h10-11,13H,2-9H2,1H3,(H,15,16)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | VLDDGSQWBQYZMP-ZMJPVWNMSA-N |
| XLogP | 2.39 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|