About 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene
4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene (PubChem CID 11207164) has the molecular formula C9H16ClO3P
and a molecular weight of 238.65 g/mol. Its IUPAC name is 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene.
Molecular Properties
| Compound Name | 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene |
| PubChem CID | 11207164 |
| Molecular Formula | C9H16ClO3P |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene |
| SMILES | CCOP(=O)(C=C=C(C)CCl)OCC |
| InChI | InChI=1S/C9H16ClO3P/c1-4-12-14(11,13-5-2)7-6-9(3)8-10/h7H,4-5,8H2,1-3H3 |
| InChIKey | ZAADUGPXYGRWPU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene?
The IUPAC name of 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene (CID 11207164) is 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene.
What is the SMILES notation for 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene?
The canonical SMILES for 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene is CCOP(=O)(C=C=C(C)CCl)OCC.
What is the InChIKey of 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene?
The InChIKey is ZAADUGPXYGRWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClO3P/c1-4-12-14(11,13-5-2)7-6-9(3)8-10/h7H,4-5,8H2,1-3H3.
What are the key properties of 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene?
4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene has a molecular weight of 238.65 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-diethoxyphosphoryl-3-methylbuta-1,2-diene is sourced from PubChem (CID 11207164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).