C13H20O4 — CID 11207194
(3aS,4R,7aR)-6-(hydroxymethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-ol (PubChem CID 11207194) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3aS,4R,7aR)-6-(hydroxymethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-ol.
| Compound Name | (3aS,4R,7aR)-6-(hydroxymethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 11207194 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3aS,4R,7aR)-6-(hydroxymethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-ol |
| SMILES | OCC1=C[C@H]2OC3(CCCCC3)O[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C13H20O4/c14-8-9-6-10(15)12-11(7-9)16-13(17-12)4-2-1-3-5-13/h7,10-12,14-15H,1-6,8H2/t10-,11-,12+/m1/s1 |
| InChIKey | MRMSSTDNRQUBMM-UTUOFQBUSA-N |
| XLogP | 1.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|