C15H22O3 — CID 11207454
(3R,3aR,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,8-tetrahydroazulene-4,7-dione (PubChem CID 11207454) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,3aR,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,8-tetrahydroazulene-4,7-dione.
| Compound Name | (3R,3aR,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,8-tetrahydroazulene-4,7-dione |
|---|---|
| PubChem CID | 11207454 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3R,3aR,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,8-tetrahydroazulene-4,7-dione |
| SMILES | CC1=CC(=O)[C@@H]2[C@](C)(CC[C@@]2(O)C(C)C)CC1=O |
| InChI | InChI=1S/C15H22O3/c1-9(2)15(18)6-5-14(4)8-12(17)10(3)7-11(16)13(14)15/h7,9,13,18H,5-6,8H2,1-4H3/t13-,14-,15-/m1/s1 |
| InChIKey | ZXKNFFWIVMCXAG-RBSFLKMASA-N |
| XLogP | 2.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |