About methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate
methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate (PubChem CID 11207506) has the molecular formula C13H13F2NO2
and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate |
| PubChem CID | 11207506 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate |
| SMILES | COC(=O)/C=C1/c2ccccc2NCCC1(F)F |
| InChI | InChI=1S/C13H13F2NO2/c1-18-12(17)8-10-9-4-2-3-5-11(9)16-7-6-13(10,14)15/h2-5,8,16H,6-7H2,1H3/b10-8- |
| InChIKey | HNTTUOZVNTUYCD-NTMALXAHSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate?
The IUPAC name of methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate (CID 11207506) is methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate.
What is the SMILES notation for methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate?
The canonical SMILES for methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate is COC(=O)/C=C1/c2ccccc2NCCC1(F)F.
What is the InChIKey of methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate?
The InChIKey is HNTTUOZVNTUYCD-NTMALXAHSA-N. The full InChI is InChI=1S/C13H13F2NO2/c1-18-12(17)8-10-9-4-2-3-5-11(9)16-7-6-13(10,14)15/h2-5,8,16H,6-7H2,1H3/b10-8-.
What are the key properties of methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate?
methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate has a molecular weight of 253.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-(4,4-difluoro-2,3-dihydro-1H-1-benzazepin-5-ylidene)acetate is sourced from PubChem (CID 11207506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).