C17H24O2 — CID 11207689
(4aS,8R,8aR)-8-hydroxy-1,4a,8a-trimethyl-4,6,7,8,9,10-hexahydro-3H-phenanthren-2-one (PubChem CID 11207689) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aS,8R,8aR)-8-hydroxy-1,4a,8a-trimethyl-4,6,7,8,9,10-hexahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,8R,8aR)-8-hydroxy-1,4a,8a-trimethyl-4,6,7,8,9,10-hexahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 11207689 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4aS,8R,8aR)-8-hydroxy-1,4a,8a-trimethyl-4,6,7,8,9,10-hexahydro-3H-phenanthren-2-one |
| SMILES | CC1=C2CC[C@]3(C)C(=CCC[C@H]3O)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C17H24O2/c1-11-12-7-9-17(3)14(5-4-6-15(17)19)16(12,2)10-8-13(11)18/h5,15,19H,4,6-10H2,1-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | KKAPZVKSABZOMX-IXDOHACOSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|