C16H32O3 — CID 11208035
1,12-dihydroxy-2,2,11,11-tetramethyldodecan-6-one (PubChem CID 11208035) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is 1,12-dihydroxy-2,2,11,11-tetramethyldodecan-6-one.
| Compound Name | 1,12-dihydroxy-2,2,11,11-tetramethyldodecan-6-one |
|---|---|
| PubChem CID | 11208035 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 1,12-dihydroxy-2,2,11,11-tetramethyldodecan-6-one |
| SMILES | CC(C)(CO)CCCCC(=O)CCCC(C)(C)CO |
| InChI | InChI=1S/C16H32O3/c1-15(2,12-17)10-6-5-8-14(19)9-7-11-16(3,4)13-18/h17-18H,5-13H2,1-4H3 |
| InChIKey | GWQVYNNGCSWRRC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|