C20H32 — CID 11208039
(1E,5E,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene (PubChem CID 11208039) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1E,5E,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene.
| Compound Name | (1E,5E,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene |
|---|---|
| PubChem CID | 11208039 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1E,5E,9E,12S)-1,5,9-trimethyl-12-prop-1-en-2-ylcyclotetradeca-1,5,9-triene |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,20H,1,6-7,9-10,13-15H2,2-5H3/b17-8+,18-12+,19-11+/t20-/m1/s1 |
| InChIKey | VWSPQDDPRITBAM-UYSOGGTPSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|