C14H35N5 — CID 11208063
1-N,4-N-bis[3-(ethylamino)propyl]butane-1,2,4-triamine (PubChem CID 11208063) has the molecular formula C14H35N5 and a molecular weight of 273.47 g/mol. Its IUPAC name is 1-N,4-N-bis[3-(ethylamino)propyl]butane-1,2,4-triamine.
| Compound Name | 1-N,4-N-bis[3-(ethylamino)propyl]butane-1,2,4-triamine |
|---|---|
| PubChem CID | 11208063 |
| Molecular Formula | C14H35N5 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.29 |
| IUPAC Name | 1-N,4-N-bis[3-(ethylamino)propyl]butane-1,2,4-triamine |
| SMILES | CCNCCCNCCC(N)CNCCCNCC |
| InChI | InChI=1S/C14H35N5/c1-3-16-8-5-10-18-12-7-14(15)13-19-11-6-9-17-4-2/h14,16-19H,3-13,15H2,1-2H3 |
| InChIKey | JHKFBFYCWKXNIG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|