C18H17NO2 — CID 11208231
6,7-dimethoxy-2-phenylnaphthalen-1-amine (PubChem CID 11208231) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6,7-dimethoxy-2-phenylnaphthalen-1-amine.
| Compound Name | 6,7-dimethoxy-2-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 11208231 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 6,7-dimethoxy-2-phenylnaphthalen-1-amine |
| SMILES | COc1cc2ccc(-c3ccccc3)c(N)c2cc1OC |
| InChI | InChI=1S/C18H17NO2/c1-20-16-10-13-8-9-14(12-6-4-3-5-7-12)18(19)15(13)11-17(16)21-2/h3-11H,19H2,1-2H3 |
| InChIKey | LTZNNGFKRPCZMZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|