C19H20O2 — CID 11208265
(E)-5-hydroxy-1,7-diphenylhept-1-en-3-one (PubChem CID 11208265) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (E)-5-hydroxy-1,7-diphenylhept-1-en-3-one.
| Compound Name | (E)-5-hydroxy-1,7-diphenylhept-1-en-3-one |
|---|---|
| PubChem CID | 11208265 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (E)-5-hydroxy-1,7-diphenylhept-1-en-3-one |
| SMILES | O=C(/C=C/c1ccccc1)CC(O)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,19,21H,12,14-15H2/b13-11+ |
| InChIKey | OUAINJWTDRNZIJ-ACCUITESSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|