C22H16 — CID 11208267
1,2-diphenylnaphthalene (PubChem CID 11208267) has the molecular formula C22H16 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,2-diphenylnaphthalene.
| Compound Name | 1,2-diphenylnaphthalene |
|---|---|
| PubChem CID | 11208267 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1,2-diphenylnaphthalene |
| SMILES | c1ccc(-c2ccc3ccccc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16/c1-3-9-17(10-4-1)21-16-15-18-11-7-8-14-20(18)22(21)19-12-5-2-6-13-19/h1-16H |
| InChIKey | ZNVZNEACQAUNGE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |