About [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate
[(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate (PubChem CID 11208375) has the molecular formula C17H16O2S
and a molecular weight of 284.38 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate.
Molecular Properties
| Compound Name | [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate |
| PubChem CID | 11208375 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H16O2S/c18-17(14-20-16-11-5-2-6-12-16)19-13-7-10-15-8-3-1-4-9-15/h1-12H,13-14H2/b10-7+ |
| InChIKey | RXGQIASEHZTGML-JXMROGBWSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate?
The IUPAC name of [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate (CID 11208375) is [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate.
What is the SMILES notation for [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate?
The canonical SMILES for [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate is O=C(CSc1ccccc1)OC/C=C/c1ccccc1.
What is the InChIKey of [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate?
The InChIKey is RXGQIASEHZTGML-JXMROGBWSA-N. The full InChI is InChI=1S/C17H16O2S/c18-17(14-20-16-11-5-2-6-12-16)19-13-7-10-15-8-3-1-4-9-15/h1-12H,13-14H2/b10-7+.
What are the key properties of [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate?
[(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate has a molecular weight of 284.38 g/mol, XLogP of 4.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-phenylprop-2-enyl] 2-phenylsulfanylacetate is sourced from PubChem (CID 11208375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).