About 2-amino-2-phenylnonanoic acid
2-amino-2-phenylnonanoic acid (PubChem CID 11208399) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-amino-2-phenylnonanoic acid.
Molecular Properties
| Compound Name | 2-amino-2-phenylnonanoic acid |
| PubChem CID | 11208399 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-amino-2-phenylnonanoic acid |
| SMILES | CCCCCCCC(N)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-9-12-15(16,14(17)18)13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12,16H2,1H3,(H,17,18) |
| InChIKey | OANXCGVBLKXTCH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-phenylnonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-phenylnonanoic acid?
The IUPAC name of 2-amino-2-phenylnonanoic acid (CID 11208399) is 2-amino-2-phenylnonanoic acid.
What is the SMILES notation for 2-amino-2-phenylnonanoic acid?
The canonical SMILES for 2-amino-2-phenylnonanoic acid is CCCCCCCC(N)(C(=O)O)c1ccccc1.
What is the InChIKey of 2-amino-2-phenylnonanoic acid?
The InChIKey is OANXCGVBLKXTCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-2-3-4-5-9-12-15(16,14(17)18)13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12,16H2,1H3,(H,17,18).
What are the key properties of 2-amino-2-phenylnonanoic acid?
2-amino-2-phenylnonanoic acid has a molecular weight of 249.35 g/mol, XLogP of 3.29, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-phenylnonanoic acid is sourced from PubChem (CID 11208399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).