About 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline
1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline (PubChem CID 11208554) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline |
| PubChem CID | 11208554 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline |
| SMILES | C/C=C/COc1ccc2c(c1)CCN=C2Cc1ccccc1 |
| InChI | InChI=1S/C20H21NO/c1-2-3-13-22-18-9-10-19-17(15-18)11-12-21-20(19)14-16-7-5-4-6-8-16/h2-10,15H,11-14H2,1H3/b3-2+ |
| InChIKey | GDWBJGPBBSKEHI-NSCUHMNNSA-N |
| XLogP | 4.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline?
The IUPAC name of 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline (CID 11208554) is 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline?
The canonical SMILES for 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline is C/C=C/COc1ccc2c(c1)CCN=C2Cc1ccccc1.
What is the InChIKey of 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline?
The InChIKey is GDWBJGPBBSKEHI-NSCUHMNNSA-N. The full InChI is InChI=1S/C20H21NO/c1-2-3-13-22-18-9-10-19-17(15-18)11-12-21-20(19)14-16-7-5-4-6-8-16/h2-10,15H,11-14H2,1H3/b3-2+.
What are the key properties of 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline?
1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline has a molecular weight of 291.39 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-6-[(E)-but-2-enoxy]-3,4-dihydroisoquinoline is sourced from PubChem (CID 11208554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).