About [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate
[(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate (PubChem CID 11208708) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate.
Molecular Properties
| Compound Name | [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate |
| PubChem CID | 11208708 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC(=O)N[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-11(19)21-16-15(18-17(20)22-16)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10,15-16H,1H3,(H,18,20)/t15-,16+/m1/s1 |
| InChIKey | DDWLCQWKPJZFIX-CVEARBPZSA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate?
The IUPAC name of [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate (CID 11208708) is [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate.
What is the SMILES notation for [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate?
The canonical SMILES for [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate is CC(=O)O[C@H]1OC(=O)N[C@@H]1c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate?
The InChIKey is DDWLCQWKPJZFIX-CVEARBPZSA-N. The full InChI is InChI=1S/C17H15NO4/c1-11(19)21-16-15(18-17(20)22-16)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10,15-16H,1H3,(H,18,20)/t15-,16+/m1/s1.
What are the key properties of [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate?
[(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate has a molecular weight of 297.31 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-2-oxo-4-(4-phenylphenyl)-1,3-oxazolidin-5-yl] acetate is sourced from PubChem (CID 11208708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).