C18H19NO3 — CID 11208717
(3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 11208717) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 11208717 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3S,4S)-1-oxido-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | [O-][N+]1=C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO3/c20-19-11-17(21-13-15-7-3-1-4-8-15)18(12-19)22-14-16-9-5-2-6-10-16/h1-11,17-18H,12-14H2/t17-,18-/m0/s1 |
| InChIKey | JEMFJYKLXPTMFU-ROUUACIJSA-N |
| XLogP | 2.75 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|