C13H18F3N5 — CID 11208834
2-[6-propan-2-yl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine (PubChem CID 11208834) has the molecular formula C13H18F3N5 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[6-propan-2-yl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine.
| Compound Name | 2-[6-propan-2-yl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine |
|---|---|
| PubChem CID | 11208834 |
| Molecular Formula | C13H18F3N5 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[6-propan-2-yl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]guanidine |
| SMILES | CC(C)C1CCc2nc(N=C(N)N)nc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C13H18F3N5/c1-6(2)7-3-4-9-8(5-7)10(13(14,15)16)20-12(19-9)21-11(17)18/h6-7H,3-5H2,1-2H3,(H4,17,18,19,20,21) |
| InChIKey | FPTNCEKIDSBEQH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|