C12H13F3O6 — CID 11209080
4-O-ethyl 1-O,2-O-dimethyl (1Z,3Z)-3-(trifluoromethyl)buta-1,3-diene-1,2,4-tricarboxylate (PubChem CID 11209080) has the molecular formula C12H13F3O6 and a molecular weight of 310.22 g/mol. Its IUPAC name is 4-O-ethyl 1-O,2-O-dimethyl (1Z,3Z)-3-(trifluoromethyl)buta-1,3-diene-1,2,4-tricarboxylate.
| Compound Name | 4-O-ethyl 1-O,2-O-dimethyl (1Z,3Z)-3-(trifluoromethyl)buta-1,3-diene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 11209080 |
| Molecular Formula | C12H13F3O6 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-O-ethyl 1-O,2-O-dimethyl (1Z,3Z)-3-(trifluoromethyl)buta-1,3-diene-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)/C=C(C(=C/C(=O)OC)/C(=O)OC)\C(F)(F)F |
| InChI | InChI=1S/C12H13F3O6/c1-4-21-10(17)6-8(12(13,14)15)7(11(18)20-3)5-9(16)19-2/h5-6H,4H2,1-3H3/b7-5-,8-6- |
| InChIKey | KCLJFUVDORAHEJ-SFECMWDFSA-N |
| XLogP | 1.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|