C18H36O2Si — CID 11209176
(3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methylundeca-1,5-diene-4,8-diol (PubChem CID 11209176) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methylundeca-1,5-diene-4,8-diol.
| Compound Name | (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methylundeca-1,5-diene-4,8-diol |
|---|---|
| PubChem CID | 11209176 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methylundeca-1,5-diene-4,8-diol |
| SMILES | C=C[C@H](C)[C@H](O)/C=C(/C[C@H](O)CCC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-9-11-15(19)12-16(13-17(20)14(3)10-2)21(7,8)18(4,5)6/h10,13-15,17,19-20H,2,9,11-12H2,1,3-8H3/b16-13-/t14-,15+,17+/m0/s1 |
| InChIKey | BOAMEZSIOIAJLM-SMGOZAFGSA-N |
| XLogP | 4.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|