C21H28N2O — CID 11209549
(1R,9S,10R)-4-amino-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one (PubChem CID 11209549) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (1R,9S,10R)-4-amino-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,10R)-4-amino-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 11209549 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (1R,9S,10R)-4-amino-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-one |
| SMILES | Nc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2=O)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C21H28N2O/c22-15-7-8-16-18(12-15)21-9-2-1-6-17(21)19(20(16)24)23(11-10-21)13-14-4-3-5-14/h7-8,12,14,17,19H,1-6,9-11,13,22H2/t17-,19-,21+/m0/s1 |
| InChIKey | RWOONUDEZVLRNB-HFSMHLIXSA-N |
| XLogP | 3.77 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|