C21H19N3O — CID 11209684
10,10-dimethyl-4-pyridin-3-yl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 11209684) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 10,10-dimethyl-4-pyridin-3-yl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-4-pyridin-3-yl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 11209684 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 10,10-dimethyl-4-pyridin-3-yl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | CC1(C)CCc2c(c3ccccc3c3[nH]c(-c4cccnc4)nc23)O1 |
| InChI | InChI=1S/C21H19N3O/c1-21(2)10-9-16-18-17(14-7-3-4-8-15(14)19(16)25-21)23-20(24-18)13-6-5-11-22-12-13/h3-8,11-12H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | NSXGBRWAHMDSRX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |