C19H14N2S2 — CID 11209838
(2Z)-2-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)-3-phenyl-3-sulfanylidenepropanenitrile (PubChem CID 11209838) has the molecular formula C19H14N2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is (2Z)-2-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)-3-phenyl-3-sulfanylidenepropanenitrile.
| Compound Name | (2Z)-2-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)-3-phenyl-3-sulfanylidenepropanenitrile |
|---|---|
| PubChem CID | 11209838 |
| Molecular Formula | C19H14N2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2Z)-2-(4-methyl-3-phenyl-1,3-thiazol-2-ylidene)-3-phenyl-3-sulfanylidenepropanenitrile |
| SMILES | CC1=CS/C(=C(/C#N)C(=S)c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C19H14N2S2/c1-14-13-23-19(21(14)16-10-6-3-7-11-16)17(12-20)18(22)15-8-4-2-5-9-15/h2-11,13H,1H3/b19-17- |
| InChIKey | XNYHXIXUZGMDQK-ZPHPHTNESA-N |
| XLogP | 5.25 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|