C26H30N4O4 — CID 1120987
cis-(1R,2S)-3-methylidene-1-N,2-N-bis(2-morpholin-4-ylphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 1120987) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is cis-(1R,2S)-3-methylidene-1-N,2-N-bis(2-morpholin-4-ylphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-3-methylidene-1-N,2-N-bis(2-morpholin-4-ylphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1120987 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | cis-(1R,2S)-3-methylidene-1-N,2-N-bis(2-morpholin-4-ylphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1[C@H](C(=O)Nc2ccccc2N2CCOCC2)[C@@H]1C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C26H30N4O4/c1-18-23(25(31)27-19-6-2-4-8-21(19)29-10-14-33-15-11-29)24(18)26(32)28-20-7-3-5-9-22(20)30-12-16-34-17-13-30/h2-9,23-24H,1,10-17H2,(H,27,31)(H,28,32)/t23-,24+ |
| InChIKey | YTDQRPUWUIFCHJ-PSWAGMNNSA-N |
| XLogP | 2.74 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|