About (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene
(4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene (PubChem CID 11209911) has the molecular formula C16H30ClO3P
and a molecular weight of 336.84 g/mol. Its IUPAC name is (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene.
Molecular Properties
| Compound Name | (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene |
| PubChem CID | 11209911 |
| Molecular Formula | C16H30ClO3P |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene |
| SMILES | CCCCC/C=C(/C=C/CCCCl)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H30ClO3P/c1-4-7-8-10-13-16(14-11-9-12-15-17)21(18,19-5-2)20-6-3/h11,13-14H,4-10,12,15H2,1-3H3/b14-11+,16-13- |
| InChIKey | KOZRXKRJDOBUPI-YLJYFMQQSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene?
The IUPAC name of (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene (CID 11209911) is (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene.
What is the SMILES notation for (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene?
The canonical SMILES for (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene is CCCCC/C=C(/C=C/CCCCl)P(=O)(OCC)OCC.
What is the InChIKey of (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene?
The InChIKey is KOZRXKRJDOBUPI-YLJYFMQQSA-N. The full InChI is InChI=1S/C16H30ClO3P/c1-4-7-8-10-13-16(14-11-9-12-15-17)21(18,19-5-2)20-6-3/h11,13-14H,4-10,12,15H2,1-3H3/b14-11+,16-13-.
What are the key properties of (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene?
(4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene has a molecular weight of 336.84 g/mol, XLogP of 6.29, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6Z)-1-chloro-6-diethoxyphosphoryldodeca-4,6-diene is sourced from PubChem (CID 11209911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).