C20H38O2Si — CID 11209955
triethyl-[[(1S,3S,6R,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-yl]oxy]silane (PubChem CID 11209955) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is triethyl-[[(1S,3S,6R,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-yl]oxy]silane.
| Compound Name | triethyl-[[(1S,3S,6R,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-yl]oxy]silane |
|---|---|
| PubChem CID | 11209955 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | triethyl-[[(1S,3S,6R,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC[C@@]2(C)CC[C@@H]3C[C@@]2(C1)OC3(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-7-23(8-2,9-3)21-17-11-13-19(6)12-10-16-14-20(19,15-17)22-18(16,4)5/h16-17H,7-15H2,1-6H3/t16-,17+,19-,20+/m1/s1 |
| InChIKey | YWAGEEPBFCFAPZ-BWPNAZKDSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|