C19H21N3OS — CID 11209975
N-[2-(aminomethyl)-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide (PubChem CID 11209975) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[2-(aminomethyl)-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide.
| Compound Name | N-[2-(aminomethyl)-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 11209975 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[2-(aminomethyl)-1,3-benzothiazol-5-yl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc3sc(CN)nc3c2)cc1 |
| InChI | InChI=1S/C19H21N3OS/c1-19(2,3)13-6-4-12(5-7-13)18(23)21-14-8-9-16-15(10-14)22-17(11-20)24-16/h4-10H,11,20H2,1-3H3,(H,21,23) |
| InChIKey | MHAZVCNABBNQFF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |