About (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate
(6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate (PubChem CID 11210047) has the molecular formula C11H13F3O5SSi
and a molecular weight of 342.37 g/mol. Its IUPAC name is (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate |
| PubChem CID | 11210047 |
| Molecular Formula | C11H13F3O5SSi |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1cc2c(cc1OS(=O)(=O)C(F)(F)F)OCO2 |
| InChI | InChI=1S/C11H13F3O5SSi/c1-21(2,3)10-5-8-7(17-6-18-8)4-9(10)19-20(15,16)11(12,13)14/h4-5H,6H2,1-3H3 |
| InChIKey | XLWUCIWUIKGPLE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate?
The IUPAC name of (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate (CID 11210047) is (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate is C[Si](C)(C)c1cc2c(cc1OS(=O)(=O)C(F)(F)F)OCO2.
What is the InChIKey of (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate?
The InChIKey is XLWUCIWUIKGPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3O5SSi/c1-21(2,3)10-5-8-7(17-6-18-8)4-9(10)19-20(15,16)11(12,13)14/h4-5H,6H2,1-3H3.
What are the key properties of (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate?
(6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate has a molecular weight of 342.37 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-trimethylsilyl-1,3-benzodioxol-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 11210047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).