C21H24N2O3 — CID 11210346
[(8Z)-11-hydroxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 11210346) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(8Z)-11-hydroxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | [(8Z)-11-hydroxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 11210346 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(8Z)-11-hydroxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | Cn1cnc(/C=C/C(=O)OC2C/C=C\CC(O)Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-23-14-18(22-15-23)10-11-21(25)26-20-9-5-4-8-19(24)12-16-6-2-3-7-17(16)13-20/h2-7,10-11,14-15,19-20,24H,8-9,12-13H2,1H3/b5-4-,11-10+ |
| InChIKey | YAWIEGCERAXVBY-JWPKELMXSA-N |
| XLogP | 2.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|