C20H24N4O2 — CID 11210348
(2E)-N-(4-aminocyclohexyl)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide (PubChem CID 11210348) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2E)-N-(4-aminocyclohexyl)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide.
| Compound Name | (2E)-N-(4-aminocyclohexyl)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
|---|---|
| PubChem CID | 11210348 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2E)-N-(4-aminocyclohexyl)-2-(1-oxo-2,3,4,10-tetrahydroazepino[3,4-b]indol-5-ylidene)acetamide |
| SMILES | NC1CCC(NC(=O)/C=C2\CCNC(=O)c3[nH]c4ccccc4c32)CC1 |
| InChI | InChI=1S/C20H24N4O2/c21-13-5-7-14(8-6-13)23-17(25)11-12-9-10-22-20(26)19-18(12)15-3-1-2-4-16(15)24-19/h1-4,11,13-14,24H,5-10,21H2,(H,22,26)(H,23,25)/b12-11+ |
| InChIKey | ZNSKENIKKLYXRK-VAWYXSNFSA-N |
| XLogP | 2.07 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|