C19H28O4S — CID 11210361
(4R,6S)-4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-6-pent-4-enyl-1,3-dioxane (PubChem CID 11210361) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is (4R,6S)-4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-6-pent-4-enyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-6-pent-4-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 11210361 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4R,6S)-4-[2-(benzenesulfonyl)ethyl]-2,2-dimethyl-6-pent-4-enyl-1,3-dioxane |
| SMILES | C=CCCC[C@H]1C[C@H](CCS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H28O4S/c1-4-5-7-10-16-15-17(23-19(2,3)22-16)13-14-24(20,21)18-11-8-6-9-12-18/h4,6,8-9,11-12,16-17H,1,5,7,10,13-15H2,2-3H3/t16-,17-/m0/s1 |
| InChIKey | KUKCOJMWSPEBEK-IRXDYDNUSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|