C19H34O4Si — CID 11210437
tert-butyl-[[6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-4-yl]oxy]-dimethylsilane (PubChem CID 11210437) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is tert-butyl-[[6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11210437 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | tert-butyl-[[6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(E)-prop-1-enyl]-3,6-dihydro-2H-pyran-4-yl]oxy]-dimethylsilane |
| SMILES | C/C=C/C1CC(O[Si](C)(C)C(C)(C)C)=CC([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C19H34O4Si/c1-9-10-14-11-15(23-24(7,8)18(2,3)4)12-16(21-14)17-13-20-19(5,6)22-17/h9-10,12,14,16-17H,11,13H2,1-8H3/b10-9+/t14?,16?,17-/m1/s1 |
| InChIKey | RRSRZKCSQVQKFP-NBZADRRUSA-N |
| XLogP | 4.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|