C20H23O4P — CID 11210538
(3aR,5S,6R,6aR)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 11210538) has the molecular formula C20H23O4P and a molecular weight of 358.37 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6R,6aR)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 11210538 |
| Molecular Formula | C20H23O4P |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CP(c3ccccc3)c3ccccc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C20H23O4P/c1-20(2)23-18-17(21)16(22-19(18)24-20)13-25(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-19,21H,13H2,1-2H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | LNGWZAJPNMUDAG-FCGDIQPGSA-N |
| XLogP | 2.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|